C18H29N3O2 — CID 95792308
(3R,7R,8aR)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 95792308) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (3R,7R,8aR)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3R,7R,8aR)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 95792308 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (3R,7R,8aR)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | C[C@@H]1CN2C[C@H](O)C[C@@H]2CN1Cc1ccc(N(C)CCO)cc1 |
| InChI | InChI=1S/C18H29N3O2/c1-14-10-21-13-18(23)9-17(21)12-20(14)11-15-3-5-16(6-4-15)19(2)7-8-22/h3-6,14,17-18,22-23H,7-13H2,1-2H3/t14-,17-,18-/m1/s1 |
| InChIKey | YPBRTQOQDPYKRD-ZTFGCOKTSA-N |
| XLogP | 0.75 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|