C20H22INO4 — CID 95795789
[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 2-(4-iodophenoxy)acetate (PubChem CID 95795789) has the molecular formula C20H22INO4 and a molecular weight of 467.30 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 2-(4-iodophenoxy)acetate.
| Compound Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 2-(4-iodophenoxy)acetate |
|---|---|
| PubChem CID | 95795789 |
| Molecular Formula | C20H22INO4 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 2-(4-iodophenoxy)acetate |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)COC(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C20H22INO4/c1-15(7-8-16-5-3-2-4-6-16)22-19(23)13-26-20(24)14-25-18-11-9-17(21)10-12-18/h2-6,9-12,15H,7-8,13-14H2,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | WKDXYHRWONJTIU-OAHLLOKOSA-N |
| XLogP | 3.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|