C23H26N4O2S — CID 95796394
N-(2,4-dimethylphenyl)-2-[(7R)-3-(3,5-dimethylphenyl)-6-oxo-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-7-yl]acetamide (PubChem CID 95796394) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(7R)-3-(3,5-dimethylphenyl)-6-oxo-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-7-yl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(7R)-3-(3,5-dimethylphenyl)-6-oxo-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-7-yl]acetamide |
|---|---|
| PubChem CID | 95796394 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(7R)-3-(3,5-dimethylphenyl)-6-oxo-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-7-yl]acetamide |
| SMILES | Cc1cc(C)cc(N2CN=C3S[C@H](CC(=O)Nc4ccc(C)cc4C)C(=O)N3C2)c1 |
| InChI | InChI=1S/C23H26N4O2S/c1-14-5-6-19(17(4)8-14)25-21(28)11-20-22(29)27-13-26(12-24-23(27)30-20)18-9-15(2)7-16(3)10-18/h5-10,20H,11-13H2,1-4H3,(H,25,28)/t20-/m1/s1 |
| InChIKey | FSLAGYZMDWGEOZ-HXUWFJFHSA-N |
| XLogP | 3.98 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |