C24H29N3O4 — CID 95797164
(3S,3'R)-1'-[(3,4-dimethoxyphenyl)methyl]-N,N-dimethyl-1-oxospiro[2,4-dihydroisoquinoline-3,4'-pyrrolidine]-3'-carboxamide (PubChem CID 95797164) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (3S,3'R)-1'-[(3,4-dimethoxyphenyl)methyl]-N,N-dimethyl-1-oxospiro[2,4-dihydroisoquinoline-3,4'-pyrrolidine]-3'-carboxamide.
| Compound Name | (3S,3'R)-1'-[(3,4-dimethoxyphenyl)methyl]-N,N-dimethyl-1-oxospiro[2,4-dihydroisoquinoline-3,4'-pyrrolidine]-3'-carboxamide |
|---|---|
| PubChem CID | 95797164 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (3S,3'R)-1'-[(3,4-dimethoxyphenyl)methyl]-N,N-dimethyl-1-oxospiro[2,4-dihydroisoquinoline-3,4'-pyrrolidine]-3'-carboxamide |
| SMILES | COc1ccc(CN2C[C@@H](C(=O)N(C)C)[C@@]3(Cc4ccccc4C(=O)N3)C2)cc1OC |
| InChI | InChI=1S/C24H29N3O4/c1-26(2)23(29)19-14-27(13-16-9-10-20(30-3)21(11-16)31-4)15-24(19)12-17-7-5-6-8-18(17)22(28)25-24/h5-11,19H,12-15H2,1-4H3,(H,25,28)/t19-,24+/m0/s1 |
| InChIKey | WWYBLGQHJZTKNM-YADARESESA-N |
| XLogP | 1.95 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |