C17H26N4O2 — CID 95798961
N-(3-methoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 95798961) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(3-methoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(3-methoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 95798961 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-(3-methoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | COCCCNc1c(C)c(C)nc2cc(C3CCOCC3)nn12 |
| InChI | InChI=1S/C17H26N4O2/c1-12-13(2)19-16-11-15(14-5-9-23-10-6-14)20-21(16)17(12)18-7-4-8-22-3/h11,14,18H,4-10H2,1-3H3 |
| InChIKey | CVZNSEJPOVUDEA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|