C20H25NO4 — CID 95801160
methyl (1R,2R,5S)-8-[(3-methoxyphenyl)methyl]-3-oxo-2-prop-2-enyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 95801160) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is methyl (1R,2R,5S)-8-[(3-methoxyphenyl)methyl]-3-oxo-2-prop-2-enyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2R,5S)-8-[(3-methoxyphenyl)methyl]-3-oxo-2-prop-2-enyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 95801160 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | methyl (1R,2R,5S)-8-[(3-methoxyphenyl)methyl]-3-oxo-2-prop-2-enyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)C(=O)C[C@@H]2CC[C@H]1N2Cc1cccc(OC)c1 |
| InChI | InChI=1S/C20H25NO4/c1-4-10-20(19(23)25-3)17-9-8-15(12-18(20)22)21(17)13-14-6-5-7-16(11-14)24-2/h4-7,11,15,17H,1,8-10,12-13H2,2-3H3/t15-,17+,20+/m0/s1 |
| InChIKey | CGIDQQOEELFCCF-XAUMDUMWSA-N |
| XLogP | 2.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|