C24H30N2O4 — CID 110223456
1'-cyclohexyl-8-[(3-methoxyphenyl)methyl]spiro[8-azabicyclo[3.2.1]octane-2,3'-pyrrolidine]-2',3,5'-trione (PubChem CID 110223456) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 1'-cyclohexyl-8-[(3-methoxyphenyl)methyl]spiro[8-azabicyclo[3.2.1]octane-2,3'-pyrrolidine]-2',3,5'-trione.
| Compound Name | 1'-cyclohexyl-8-[(3-methoxyphenyl)methyl]spiro[8-azabicyclo[3.2.1]octane-2,3'-pyrrolidine]-2',3,5'-trione |
|---|---|
| PubChem CID | 110223456 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1'-cyclohexyl-8-[(3-methoxyphenyl)methyl]spiro[8-azabicyclo[3.2.1]octane-2,3'-pyrrolidine]-2',3,5'-trione |
| SMILES | COc1cccc(CN2C3CCC2C2(CC(=O)N(C4CCCCC4)C2=O)C(=O)C3)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-30-19-9-5-6-16(12-19)15-25-18-10-11-20(25)24(21(27)13-18)14-22(28)26(23(24)29)17-7-3-2-4-8-17/h5-6,9,12,17-18,20H,2-4,7-8,10-11,13-15H2,1H3 |
| InChIKey | AXCGONRKFKCMJZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|