C17H16ClN3O2 — CID 95802797
2-[(5R)-8-chloro-2,3,5,6-tetrahydroimidazo[1,2-c]quinazolin-5-yl]-5-methoxyphenol (PubChem CID 95802797) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 2-[(5R)-8-chloro-2,3,5,6-tetrahydroimidazo[1,2-c]quinazolin-5-yl]-5-methoxyphenol.
| Compound Name | 2-[(5R)-8-chloro-2,3,5,6-tetrahydroimidazo[1,2-c]quinazolin-5-yl]-5-methoxyphenol |
|---|---|
| PubChem CID | 95802797 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[(5R)-8-chloro-2,3,5,6-tetrahydroimidazo[1,2-c]quinazolin-5-yl]-5-methoxyphenol |
| SMILES | COc1ccc([C@@H]2Nc3cc(Cl)ccc3C3=NCCN32)c(O)c1 |
| InChI | InChI=1S/C17H16ClN3O2/c1-23-11-3-5-13(15(22)9-11)17-20-14-8-10(18)2-4-12(14)16-19-6-7-21(16)17/h2-5,8-9,17,20,22H,6-7H2,1H3/t17-/m1/s1 |
| InChIKey | SWDBLYDCUWPEKD-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|