C20H21N7O — CID 95802973
[(6aS,9aR)-2-methyl-5,6,6a,7,9,9a-hexahydropyrrolo[3,4-h]quinazolin-8-yl]-[3-(5-methyltetrazol-1-yl)phenyl]methanone (PubChem CID 95802973) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is [(6aS,9aR)-2-methyl-5,6,6a,7,9,9a-hexahydropyrrolo[3,4-h]quinazolin-8-yl]-[3-(5-methyltetrazol-1-yl)phenyl]methanone.
| Compound Name | [(6aS,9aR)-2-methyl-5,6,6a,7,9,9a-hexahydropyrrolo[3,4-h]quinazolin-8-yl]-[3-(5-methyltetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 95802973 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [(6aS,9aR)-2-methyl-5,6,6a,7,9,9a-hexahydropyrrolo[3,4-h]quinazolin-8-yl]-[3-(5-methyltetrazol-1-yl)phenyl]methanone |
| SMILES | Cc1ncc2c(n1)[C@H]1CN(C(=O)c3cccc(-n4nnnc4C)c3)C[C@H]1CC2 |
| InChI | InChI=1S/C20H21N7O/c1-12-21-9-15-6-7-16-10-26(11-18(16)19(15)22-12)20(28)14-4-3-5-17(8-14)27-13(2)23-24-25-27/h3-5,8-9,16,18H,6-7,10-11H2,1-2H3/t16-,18+/m1/s1 |
| InChIKey | JWKPTCIDLQXUTE-AEFFLSMTSA-N |
| XLogP | 1.87 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |