C19H19N5O2 — CID 74249670
[2-(3-methoxyphenyl)azetidin-1-yl]-[3-(5-methyltetrazol-1-yl)phenyl]methanone (PubChem CID 74249670) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)azetidin-1-yl]-[3-(5-methyltetrazol-1-yl)phenyl]methanone.
| Compound Name | [2-(3-methoxyphenyl)azetidin-1-yl]-[3-(5-methyltetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 74249670 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [2-(3-methoxyphenyl)azetidin-1-yl]-[3-(5-methyltetrazol-1-yl)phenyl]methanone |
| SMILES | COc1cccc(C2CCN2C(=O)c2cccc(-n3nnnc3C)c2)c1 |
| InChI | InChI=1S/C19H19N5O2/c1-13-20-21-22-24(13)16-7-3-6-15(11-16)19(25)23-10-9-18(23)14-5-4-8-17(12-14)26-2/h3-8,11-12,18H,9-10H2,1-2H3 |
| InChIKey | QBDYZEPWBTVLIL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |