C21H21BrN4O2 — CID 55889459
[2-(3-bromophenyl)pyrrolidin-1-yl]-[1-(3-methoxyphenyl)-5-methyltriazol-4-yl]methanone (PubChem CID 55889459) has the molecular formula C21H21BrN4O2 and a molecular weight of 441.33 g/mol. Its IUPAC name is [2-(3-bromophenyl)pyrrolidin-1-yl]-[1-(3-methoxyphenyl)-5-methyltriazol-4-yl]methanone.
| Compound Name | [2-(3-bromophenyl)pyrrolidin-1-yl]-[1-(3-methoxyphenyl)-5-methyltriazol-4-yl]methanone |
|---|---|
| PubChem CID | 55889459 |
| Molecular Formula | C21H21BrN4O2 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | [2-(3-bromophenyl)pyrrolidin-1-yl]-[1-(3-methoxyphenyl)-5-methyltriazol-4-yl]methanone |
| SMILES | COc1cccc(-n2nnc(C(=O)N3CCCC3c3cccc(Br)c3)c2C)c1 |
| InChI | InChI=1S/C21H21BrN4O2/c1-14-20(23-24-26(14)17-8-4-9-18(13-17)28-2)21(27)25-11-5-10-19(25)15-6-3-7-16(22)12-15/h3-4,6-9,12-13,19H,5,10-11H2,1-2H3 |
| InChIKey | XPTMSCBKLFZBBS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |