C20H26N4O3 — CID 95803082
N-[4-(diethylamino)-2-methylphenyl]-2-[(7S)-7-methyl-3-oxo-5,7-dihydrofuro[3,4-c]pyridazin-2-yl]acetamide (PubChem CID 95803082) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-[(7S)-7-methyl-3-oxo-5,7-dihydrofuro[3,4-c]pyridazin-2-yl]acetamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-[(7S)-7-methyl-3-oxo-5,7-dihydrofuro[3,4-c]pyridazin-2-yl]acetamide |
|---|---|
| PubChem CID | 95803082 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-[(7S)-7-methyl-3-oxo-5,7-dihydrofuro[3,4-c]pyridazin-2-yl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)Cn2nc3c(cc2=O)CO[C@H]3C)c(C)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-5-23(6-2)16-7-8-17(13(3)9-16)21-18(25)11-24-19(26)10-15-12-27-14(4)20(15)22-24/h7-10,14H,5-6,11-12H2,1-4H3,(H,21,25)/t14-/m0/s1 |
| InChIKey | XYRGZRJFLNDEJT-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|