C23H27N3O4 — CID 95803926
2-[4-[[(3aR,6aS)-3-(4-methylphenyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl]methyl]-2-ethoxyphenoxy]acetamide (PubChem CID 95803926) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[4-[[(3aR,6aS)-3-(4-methylphenyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl]methyl]-2-ethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[[(3aR,6aS)-3-(4-methylphenyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl]methyl]-2-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 95803926 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[4-[[(3aR,6aS)-3-(4-methylphenyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl]methyl]-2-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(CN2C[C@@H]3C(c4ccc(C)cc4)=NO[C@@H]3C2)ccc1OCC(N)=O |
| InChI | InChI=1S/C23H27N3O4/c1-3-28-20-10-16(6-9-19(20)29-14-22(24)27)11-26-12-18-21(13-26)30-25-23(18)17-7-4-15(2)5-8-17/h4-10,18,21H,3,11-14H2,1-2H3,(H2,24,27)/t18-,21+/m0/s1 |
| InChIKey | MPSLNPDDWIQUFU-GHTZIAJQSA-N |
| XLogP | 2.49 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |