C22H25FN2O4 — CID 95803970
(3aR,6aS)-3-(2-fluorophenyl)-5-[[3-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole (PubChem CID 95803970) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is (3aR,6aS)-3-(2-fluorophenyl)-5-[[3-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole.
| Compound Name | (3aR,6aS)-3-(2-fluorophenyl)-5-[[3-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole |
|---|---|
| PubChem CID | 95803970 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (3aR,6aS)-3-(2-fluorophenyl)-5-[[3-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole |
| SMILES | COCCOc1ccc(CN2C[C@@H]3C(c4ccccc4F)=NO[C@@H]3C2)cc1OC |
| InChI | InChI=1S/C22H25FN2O4/c1-26-9-10-28-19-8-7-15(11-20(19)27-2)12-25-13-17-21(14-25)29-24-22(17)16-5-3-4-6-18(16)23/h3-8,11,17,21H,9-10,12-14H2,1-2H3/t17-,21+/m0/s1 |
| InChIKey | VJZZKAWLTLRZGT-LAUBAEHRSA-N |
| XLogP | 3.09 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|