C19H30N2O6 — CID 129458771
N-[(3R,4R,6R)-3,6-dihydroxy-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]azepan-4-yl]acetamide (PubChem CID 129458771) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[(3R,4R,6R)-3,6-dihydroxy-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]azepan-4-yl]acetamide.
| Compound Name | N-[(3R,4R,6R)-3,6-dihydroxy-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]azepan-4-yl]acetamide |
|---|---|
| PubChem CID | 129458771 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[(3R,4R,6R)-3,6-dihydroxy-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]azepan-4-yl]acetamide |
| SMILES | COCCOc1cc(CN2C[C@H](O)C[C@@H](NC(C)=O)[C@H](O)C2)ccc1OC |
| InChI | InChI=1S/C19H30N2O6/c1-13(22)20-16-9-15(23)11-21(12-17(16)24)10-14-4-5-18(26-3)19(8-14)27-7-6-25-2/h4-5,8,15-17,23-24H,6-7,9-12H2,1-3H3,(H,20,22)/t15-,16-,17-/m1/s1 |
| InChIKey | VAZJHLKICCTXRR-BRWVUGGUSA-N |
| XLogP | 0.15 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|