C20H32N4O2 — CID 95808531
(4S,4aS,8aS)-1-[[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-ol (PubChem CID 95808531) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (4S,4aS,8aS)-1-[[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-ol.
| Compound Name | (4S,4aS,8aS)-1-[[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 95808531 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (4S,4aS,8aS)-1-[[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-ol |
| SMILES | C[C@@H]1CN(c2nccc(CN3CC[C@H](O)[C@H]4CCCC[C@@H]43)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H32N4O2/c1-14-11-24(12-15(2)26-14)20-21-9-7-16(22-20)13-23-10-8-19(25)17-5-3-4-6-18(17)23/h7,9,14-15,17-19,25H,3-6,8,10-13H2,1-2H3/t14-,15+,17-,18-,19-/m0/s1 |
| InChIKey | KJIXZEHJTYWXJD-PTIUUAQKSA-N |
| XLogP | 2.22 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |