C24H27FN2O2S — CID 95812788
3-[(3R)-1-[3-(4-fluorophenoxy)propyl]pyrrolidin-3-yl]-N,N-dimethyl-1-benzothiophene-2-carboxamide (PubChem CID 95812788) has the molecular formula C24H27FN2O2S and a molecular weight of 426.56 g/mol. Its IUPAC name is 3-[(3R)-1-[3-(4-fluorophenoxy)propyl]pyrrolidin-3-yl]-N,N-dimethyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[(3R)-1-[3-(4-fluorophenoxy)propyl]pyrrolidin-3-yl]-N,N-dimethyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 95812788 |
| Molecular Formula | C24H27FN2O2S |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-[(3R)-1-[3-(4-fluorophenoxy)propyl]pyrrolidin-3-yl]-N,N-dimethyl-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1sc2ccccc2c1[C@H]1CCN(CCCOc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H27FN2O2S/c1-26(2)24(28)23-22(20-6-3-4-7-21(20)30-23)17-12-14-27(16-17)13-5-15-29-19-10-8-18(25)9-11-19/h3-4,6-11,17H,5,12-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | YEXSEJQXOFPYMZ-KRWDZBQOSA-N |
| XLogP | 5.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|