C29H32N2O2S — CID 142029182
N,N-dimethyl-4-[3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzothiophene-2-carboxamide (PubChem CID 142029182) has the molecular formula C29H32N2O2S and a molecular weight of 472.65 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzothiophene-2-carboxamide.
| Compound Name | N,N-dimethyl-4-[3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 142029182 |
| Molecular Formula | C29H32N2O2S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N,N-dimethyl-4-[3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc2c(OCCCN3CCC(c4ccc5ccccc5c4)CC3)cccc2s1 |
| InChI | InChI=1S/C29H32N2O2S/c1-30(2)29(32)28-20-25-26(9-5-10-27(25)34-28)33-18-6-15-31-16-13-22(14-17-31)24-12-11-21-7-3-4-8-23(21)19-24/h3-5,7-12,19-20,22H,6,13-18H2,1-2H3 |
| InChIKey | YXJPOVGTEWJHTQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|