C31H36N2O2S — CID 142029125
acetylene;4-[3-[4-[3,4-bis(ethenyl)phenyl]piperidin-1-yl]propoxy]-N,N-dimethyl-1-benzothiophene-2-carboxamide (PubChem CID 142029125) has the molecular formula C31H36N2O2S and a molecular weight of 500.71 g/mol. Its IUPAC name is acetylene;4-[3-[4-[3,4-bis(ethenyl)phenyl]piperidin-1-yl]propoxy]-N,N-dimethyl-1-benzothiophene-2-carboxamide.
| Compound Name | acetylene;4-[3-[4-[3,4-bis(ethenyl)phenyl]piperidin-1-yl]propoxy]-N,N-dimethyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 142029125 |
| Molecular Formula | C31H36N2O2S |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | acetylene;4-[3-[4-[3,4-bis(ethenyl)phenyl]piperidin-1-yl]propoxy]-N,N-dimethyl-1-benzothiophene-2-carboxamide |
| SMILES | C#C.C=Cc1ccc(C2CCN(CCCOc3cccc4sc(C(=O)N(C)C)cc34)CC2)cc1C=C |
| InChI | InChI=1S/C29H34N2O2S.C2H2/c1-5-21-11-12-24(19-22(21)6-2)23-13-16-31(17-14-23)15-8-18-33-26-9-7-10-27-25(26)20-28(34-27)29(32)30(3)4;1-2/h5-7,9-12,19-20,23H,1-2,8,13-18H2,3-4H3;1-2H |
| InChIKey | PDPOHOYDYXMLQM-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|