C36H44N2O2 — CID 142029193
acetylene;(E)-N,N-diethyl-1-[4-[3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzofuran-2-yl]but-1-en-1-amine (PubChem CID 142029193) has the molecular formula C36H44N2O2 and a molecular weight of 536.76 g/mol. Its IUPAC name is acetylene;(E)-N,N-diethyl-1-[4-[3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzofuran-2-yl]but-1-en-1-amine.
| Compound Name | acetylene;(E)-N,N-diethyl-1-[4-[3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzofuran-2-yl]but-1-en-1-amine |
|---|---|
| PubChem CID | 142029193 |
| Molecular Formula | C36H44N2O2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | acetylene;(E)-N,N-diethyl-1-[4-[3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzofuran-2-yl]but-1-en-1-amine |
| SMILES | C#C.CC/C=C(\c1cc2c(OCCCN3CCC(c4ccc5ccccc5c4)CC3)cccc2o1)N(CC)CC |
| InChI | InChI=1S/C34H42N2O2.C2H2/c1-4-11-31(36(5-2)6-3)34-25-30-32(14-9-15-33(30)38-34)37-23-10-20-35-21-18-27(19-22-35)29-17-16-26-12-7-8-13-28(26)24-29;1-2/h7-9,11-17,24-25,27H,4-6,10,18-23H2,1-3H3;1-2H/b31-11+; |
| InChIKey | IVAWOURYJNZVSE-AZYUAZSFSA-N |
| XLogP | 8.58 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|