C28H34N4O3 — CID 142029398
ethanimidoyl 4-[3-[4-(1-methyl-2,3-dihydroindol-5-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate (PubChem CID 142029398) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is ethanimidoyl 4-[3-[4-(1-methyl-2,3-dihydroindol-5-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate.
| Compound Name | ethanimidoyl 4-[3-[4-(1-methyl-2,3-dihydroindol-5-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate |
|---|---|
| PubChem CID | 142029398 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | ethanimidoyl 4-[3-[4-(1-methyl-2,3-dihydroindol-5-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1cc2c(OCCCN3CCC(c4ccc5c(c4)CCN5C)CC3)cccc2o1 |
| InChI | InChI=1S/C28H34N4O3/c1-19(29)34-28(30)27-18-23-25(5-3-6-26(23)35-27)33-16-4-12-32-14-10-20(11-15-32)21-7-8-24-22(17-21)9-13-31(24)2/h3,5-8,17-18,20,29-30H,4,9-16H2,1-2H3/b29-19+,30-28- |
| InChIKey | MBQSHVGCEQTSSC-AKMUCKKWSA-N |
| XLogP | 5.41 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|