C29H31N3O4S — CID 142029351
(C-methylsulfanylcarbonimidoyl) 4-[(2R)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzofuran-2-carboximidate (PubChem CID 142029351) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is (C-methylsulfanylcarbonimidoyl) 4-[(2R)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzofuran-2-carboximidate.
| Compound Name | (C-methylsulfanylcarbonimidoyl) 4-[(2R)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzofuran-2-carboximidate |
|---|---|
| PubChem CID | 142029351 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | (C-methylsulfanylcarbonimidoyl) 4-[(2R)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-benzofuran-2-carboximidate |
| SMILES | [H]/N=C(/O/C(=N\[H])c1cc2c(OC[C@H](O)CN3CCC(c4ccc5ccccc5c4)CC3)cccc2o1)SC |
| InChI | InChI=1S/C29H31N3O4S/c1-37-29(31)36-28(30)27-16-24-25(7-4-8-26(24)35-27)34-18-23(33)17-32-13-11-20(12-14-32)22-10-9-19-5-2-3-6-21(19)15-22/h2-10,15-16,20,23,30-31,33H,11-14,17-18H2,1H3/b30-28-,31-29-/t23-/m1/s1 |
| InChIKey | STSDDOAHPSQHTF-VAFKYMCOSA-N |
| XLogP | 5.85 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|