C26H29N3O6 — CID 142029295
(C-methoxycarbonimidoyl) 4-[3-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate (PubChem CID 142029295) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is (C-methoxycarbonimidoyl) 4-[3-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate.
| Compound Name | (C-methoxycarbonimidoyl) 4-[3-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate |
|---|---|
| PubChem CID | 142029295 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (C-methoxycarbonimidoyl) 4-[3-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])OC)c1cc2c(OCCCN3CCC(c4ccc5c(c4)OCO5)CC3)cccc2o1 |
| InChI | InChI=1S/C26H29N3O6/c1-30-26(28)35-25(27)24-15-19-20(4-2-5-21(19)34-24)31-13-3-10-29-11-8-17(9-12-29)18-6-7-22-23(14-18)33-16-32-22/h2,4-7,14-15,17,27-28H,3,8-13,16H2,1H3/b27-25-,28-26+ |
| InChIKey | JPROIJUTEZCPHJ-ZQZMJUSDSA-N |
| XLogP | 4.73 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|