C29H37N3O2 — CID 142029208
N-[3-[[2-(cyclobutanecarboximidoyl)-1-benzofuran-4-yl]oxy]propyl]-1-[(3-methylphenyl)methyl]piperidin-4-amine (PubChem CID 142029208) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is N-[3-[[2-(cyclobutanecarboximidoyl)-1-benzofuran-4-yl]oxy]propyl]-1-[(3-methylphenyl)methyl]piperidin-4-amine.
| Compound Name | N-[3-[[2-(cyclobutanecarboximidoyl)-1-benzofuran-4-yl]oxy]propyl]-1-[(3-methylphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 142029208 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | N-[3-[[2-(cyclobutanecarboximidoyl)-1-benzofuran-4-yl]oxy]propyl]-1-[(3-methylphenyl)methyl]piperidin-4-amine |
| SMILES | [H]/N=C(/c1cc2c(OCCCNC3CCN(Cc4cccc(C)c4)CC3)cccc2o1)C1CCC1 |
| InChI | InChI=1S/C29H37N3O2/c1-21-6-2-7-22(18-21)20-32-15-12-24(13-16-32)31-14-5-17-33-26-10-4-11-27-25(26)19-28(34-27)29(30)23-8-3-9-23/h2,4,6-7,10-11,18-19,23-24,30-31H,3,5,8-9,12-17,20H2,1H3/b30-29+ |
| InChIKey | VLPYLBOGPGBODU-QVIHXGFCSA-N |
| XLogP | 5.93 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|