C28H35N3O4 — CID 142029198
1-aminoethyl 4-[3-[4-(3,4-dihydro-2H-chromen-6-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate (PubChem CID 142029198) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-aminoethyl 4-[3-[4-(3,4-dihydro-2H-chromen-6-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate.
| Compound Name | 1-aminoethyl 4-[3-[4-(3,4-dihydro-2H-chromen-6-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate |
|---|---|
| PubChem CID | 142029198 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 1-aminoethyl 4-[3-[4-(3,4-dihydro-2H-chromen-6-yl)piperidin-1-yl]propoxy]-1-benzofuran-2-carboximidate |
| SMILES | [H]/N=C(\OC(C)N)c1cc2c(OCCCN3CCC(c4ccc5c(c4)CCCO5)CC3)cccc2o1 |
| InChI | InChI=1S/C28H35N3O4/c1-19(29)34-28(30)27-18-23-25(6-2-7-26(23)35-27)33-16-4-12-31-13-10-20(11-14-31)21-8-9-24-22(17-21)5-3-15-32-24/h2,6-9,17-20,30H,3-5,10-16,29H2,1H3/b30-28- |
| InChIKey | DSWHQYTUOBQAME-HYOGKJQXSA-N |
| XLogP | 5.05 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|