C27H30Cl2N2O3 — CID 142029186
2-[4-[3-[4-(3,4-dichlorophenyl)piperidin-1-yl]propoxy]-1-benzofuran-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 142029186) has the molecular formula C27H30Cl2N2O3 and a molecular weight of 501.45 g/mol. Its IUPAC name is 2-[4-[3-[4-(3,4-dichlorophenyl)piperidin-1-yl]propoxy]-1-benzofuran-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[4-[3-[4-(3,4-dichlorophenyl)piperidin-1-yl]propoxy]-1-benzofuran-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 142029186 |
| Molecular Formula | C27H30Cl2N2O3 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-[4-[3-[4-(3,4-dichlorophenyl)piperidin-1-yl]propoxy]-1-benzofuran-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cc3c(OCCCN4CCC(c5ccc(Cl)c(Cl)c5)CC4)cccc3o2)=N1 |
| InChI | InChI=1S/C27H30Cl2N2O3/c1-27(2)17-33-26(30-27)25-16-20-23(5-3-6-24(20)34-25)32-14-4-11-31-12-9-18(10-13-31)19-7-8-21(28)22(29)15-19/h3,5-8,15-16,18H,4,9-14,17H2,1-2H3 |
| InChIKey | DBTBBFNLQOFPKR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 47.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|