C16H17ClN2 — CID 95816697
2-[(4-chlorophenyl)methyl]-6-[(2S)-pyrrolidin-2-yl]pyridine (PubChem CID 95816697) has the molecular formula C16H17ClN2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-6-[(2S)-pyrrolidin-2-yl]pyridine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-6-[(2S)-pyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 95816697 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-6-[(2S)-pyrrolidin-2-yl]pyridine |
| SMILES | Clc1ccc(Cc2cccc([C@@H]3CCCN3)n2)cc1 |
| InChI | InChI=1S/C16H17ClN2/c17-13-8-6-12(7-9-13)11-14-3-1-4-16(19-14)15-5-2-10-18-15/h1,3-4,6-9,15,18H,2,5,10-11H2/t15-/m0/s1 |
| InChIKey | RSZGJWGZTQCTGB-HNNXBMFYSA-N |
| XLogP | 3.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |