C16H19Cl2N3 — CID 68819818
5-[(4-chlorophenyl)methyl]-4-methyl-2-pyrrolidin-2-ylpyrimidine;hydrochloride (PubChem CID 68819818) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.25 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl]-4-methyl-2-pyrrolidin-2-ylpyrimidine;hydrochloride.
| Compound Name | 5-[(4-chlorophenyl)methyl]-4-methyl-2-pyrrolidin-2-ylpyrimidine;hydrochloride |
|---|---|
| PubChem CID | 68819818 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl]-4-methyl-2-pyrrolidin-2-ylpyrimidine;hydrochloride |
| SMILES | Cc1nc(C2CCCN2)ncc1Cc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C16H18ClN3.ClH/c1-11-13(9-12-4-6-14(17)7-5-12)10-19-16(20-11)15-3-2-8-18-15;/h4-7,10,15,18H,2-3,8-9H2,1H3;1H |
| InChIKey | OYAAGIMFZMXHGA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |