C24H25ClN4O — CID 95819285
N-[4-[[(3S)-3-[3-(3-chlorophenyl)pyrazin-2-yl]piperidin-1-yl]methyl]phenyl]acetamide (PubChem CID 95819285) has the molecular formula C24H25ClN4O and a molecular weight of 420.94 g/mol. Its IUPAC name is N-[4-[[(3S)-3-[3-(3-chlorophenyl)pyrazin-2-yl]piperidin-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[(3S)-3-[3-(3-chlorophenyl)pyrazin-2-yl]piperidin-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 95819285 |
| Molecular Formula | C24H25ClN4O |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[4-[[(3S)-3-[3-(3-chlorophenyl)pyrazin-2-yl]piperidin-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCC[C@H](c3nccnc3-c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C24H25ClN4O/c1-17(30)28-22-9-7-18(8-10-22)15-29-13-3-5-20(16-29)24-23(26-11-12-27-24)19-4-2-6-21(25)14-19/h2,4,6-12,14,20H,3,5,13,15-16H2,1H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | PKURZKJGPZWNPI-FQEVSTJZSA-N |
| XLogP | 5.14 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |