C20H22N6O — CID 95821022
(2S)-2-[4-(2-amino-4-pyridinyl)-1H-pyrazol-5-yl]-N-phenylpiperidine-1-carboxamide (PubChem CID 95821022) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is (2S)-2-[4-(2-amino-4-pyridinyl)-1H-pyrazol-5-yl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | (2S)-2-[4-(2-amino-4-pyridinyl)-1H-pyrazol-5-yl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 95821022 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (2S)-2-[4-(2-amino-4-pyridinyl)-1H-pyrazol-5-yl]-N-phenylpiperidine-1-carboxamide |
| SMILES | Nc1cc(-c2cn[nH]c2[C@@H]2CCCCN2C(=O)Nc2ccccc2)ccn1 |
| InChI | InChI=1S/C20H22N6O/c21-18-12-14(9-10-22-18)16-13-23-25-19(16)17-8-4-5-11-26(17)20(27)24-15-6-2-1-3-7-15/h1-3,6-7,9-10,12-13,17H,4-5,8,11H2,(H2,21,22)(H,23,25)(H,24,27)/t17-/m0/s1 |
| InChIKey | FTKDGZPVVFKSGT-KRWDZBQOSA-N |
| XLogP | 3.81 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |