C22H26N6O — CID 95821027
(3S)-3-[4-(2-amino-4-pyridinyl)-1H-pyrazol-5-yl]-N-(2-phenylethyl)piperidine-1-carboxamide (PubChem CID 95821027) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is (3S)-3-[4-(2-amino-4-pyridinyl)-1H-pyrazol-5-yl]-N-(2-phenylethyl)piperidine-1-carboxamide.
| Compound Name | (3S)-3-[4-(2-amino-4-pyridinyl)-1H-pyrazol-5-yl]-N-(2-phenylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95821027 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (3S)-3-[4-(2-amino-4-pyridinyl)-1H-pyrazol-5-yl]-N-(2-phenylethyl)piperidine-1-carboxamide |
| SMILES | Nc1cc(-c2cn[nH]c2[C@H]2CCCN(C(=O)NCCc3ccccc3)C2)ccn1 |
| InChI | InChI=1S/C22H26N6O/c23-20-13-17(9-11-24-20)19-14-26-27-21(19)18-7-4-12-28(15-18)22(29)25-10-8-16-5-2-1-3-6-16/h1-3,5-6,9,11,13-14,18H,4,7-8,10,12,15H2,(H2,23,24)(H,25,29)(H,26,27)/t18-/m0/s1 |
| InChIKey | CJBQRHACDXKBDP-SFHVURJKSA-N |
| XLogP | 3.19 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |