C20H20FN5O2 — CID 95823308
1-[4-[3-(2-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-2-pyrazol-1-ylethanone (PubChem CID 95823308) has the molecular formula C20H20FN5O2 and a molecular weight of 381.41 g/mol. Its IUPAC name is 1-[4-[3-(2-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-2-pyrazol-1-ylethanone.
| Compound Name | 1-[4-[3-(2-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 95823308 |
| Molecular Formula | C20H20FN5O2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-[4-[3-(2-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-2-pyrazol-1-ylethanone |
| SMILES | O=C(Cn1cccn1)N1CCC(c2nccnc2Oc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H20FN5O2/c21-16-4-1-2-5-17(16)28-20-19(22-9-10-23-20)15-6-12-25(13-7-15)18(27)14-26-11-3-8-24-26/h1-5,8-11,15H,6-7,12-14H2 |
| InChIKey | VEYUEFYQCUTLJG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |