C15H20N6 — CID 95825535
5-[(3S)-piperidin-3-yl]-N-(2-pyrazin-2-ylethyl)pyrazin-2-amine (PubChem CID 95825535) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 5-[(3S)-piperidin-3-yl]-N-(2-pyrazin-2-ylethyl)pyrazin-2-amine.
| Compound Name | 5-[(3S)-piperidin-3-yl]-N-(2-pyrazin-2-ylethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 95825535 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 5-[(3S)-piperidin-3-yl]-N-(2-pyrazin-2-ylethyl)pyrazin-2-amine |
| SMILES | c1cnc(CCNc2cnc([C@H]3CCCNC3)cn2)cn1 |
| InChI | InChI=1S/C15H20N6/c1-2-12(8-16-4-1)14-10-21-15(11-20-14)19-5-3-13-9-17-6-7-18-13/h6-7,9-12,16H,1-5,8H2,(H,19,21)/t12-/m0/s1 |
| InChIKey | QFHHXKMLRSBWEZ-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |