C11H16F2N4 — CID 95846721
N-(2,2-difluoroethyl)-5-[(3S)-piperidin-3-yl]pyrazin-2-amine (PubChem CID 95846721) has the molecular formula C11H16F2N4 and a molecular weight of 242.27 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-5-[(3S)-piperidin-3-yl]pyrazin-2-amine.
| Compound Name | N-(2,2-difluoroethyl)-5-[(3S)-piperidin-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 95846721 |
| Molecular Formula | C11H16F2N4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-(2,2-difluoroethyl)-5-[(3S)-piperidin-3-yl]pyrazin-2-amine |
| SMILES | FC(F)CNc1cnc([C@H]2CCCNC2)cn1 |
| InChI | InChI=1S/C11H16F2N4/c12-10(13)6-17-11-7-15-9(5-16-11)8-2-1-3-14-4-8/h5,7-8,10,14H,1-4,6H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | HUWFCHXNWPUYDJ-QMMMGPOBSA-N |
| XLogP | 1.62 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |