C13H13ClN4O — CID 958256
[[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylideneamino]urea (PubChem CID 958256) has the molecular formula C13H13ClN4O and a molecular weight of 276.73 g/mol. Its IUPAC name is [[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylideneamino]urea.
| Compound Name | [[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 958256 |
| Molecular Formula | C13H13ClN4O |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylideneamino]urea |
| SMILES | Cc1ccc(-n2cccc2C=NNC(N)=O)cc1Cl |
| InChI | InChI=1S/C13H13ClN4O/c1-9-4-5-10(7-12(9)14)18-6-2-3-11(18)8-16-17-13(15)19/h2-8H,1H3,(H3,15,17,19) |
| InChIKey | GBBPRQOLPKJVRC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|