C17H27N3O — CID 95825665
N-[[(2R)-2-methyloxolan-2-yl]methyl]-4-(1-methylpiperidin-4-yl)pyridin-2-amine (PubChem CID 95825665) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[[(2R)-2-methyloxolan-2-yl]methyl]-4-(1-methylpiperidin-4-yl)pyridin-2-amine.
| Compound Name | N-[[(2R)-2-methyloxolan-2-yl]methyl]-4-(1-methylpiperidin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 95825665 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-[[(2R)-2-methyloxolan-2-yl]methyl]-4-(1-methylpiperidin-4-yl)pyridin-2-amine |
| SMILES | CN1CCC(c2ccnc(NC[C@@]3(C)CCCO3)c2)CC1 |
| InChI | InChI=1S/C17H27N3O/c1-17(7-3-11-21-17)13-19-16-12-15(4-8-18-16)14-5-9-20(2)10-6-14/h4,8,12,14H,3,5-7,9-11,13H2,1-2H3,(H,18,19)/t17-/m1/s1 |
| InChIKey | GXIPZLADIWYBEU-QGZVFWFLSA-N |
| XLogP | 2.87 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |