C16H19FN4O — CID 95826543
N-[(4-fluorophenyl)methyl]-2-methyl-6-[(3S)-morpholin-3-yl]pyrimidin-4-amine (PubChem CID 95826543) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-methyl-6-[(3S)-morpholin-3-yl]pyrimidin-4-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-methyl-6-[(3S)-morpholin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 95826543 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-methyl-6-[(3S)-morpholin-3-yl]pyrimidin-4-amine |
| SMILES | Cc1nc(NCc2ccc(F)cc2)cc([C@H]2COCCN2)n1 |
| InChI | InChI=1S/C16H19FN4O/c1-11-20-14(15-10-22-7-6-18-15)8-16(21-11)19-9-12-2-4-13(17)5-3-12/h2-5,8,15,18H,6-7,9-10H2,1H3,(H,19,20,21)/t15-/m1/s1 |
| InChIKey | HFCXMDUQYVPHHI-OAHLLOKOSA-N |
| XLogP | 2.20 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |