C19H19FN4O2 — CID 119067930
7-fluoro-3-[[[2-methyl-6-(oxolan-3-yl)pyrimidin-4-yl]amino]methyl]-1H-quinolin-2-one (PubChem CID 119067930) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is 7-fluoro-3-[[[2-methyl-6-(oxolan-3-yl)pyrimidin-4-yl]amino]methyl]-1H-quinolin-2-one.
| Compound Name | 7-fluoro-3-[[[2-methyl-6-(oxolan-3-yl)pyrimidin-4-yl]amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 119067930 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 7-fluoro-3-[[[2-methyl-6-(oxolan-3-yl)pyrimidin-4-yl]amino]methyl]-1H-quinolin-2-one |
| SMILES | Cc1nc(NCc2cc3ccc(F)cc3[nH]c2=O)cc(C2CCOC2)n1 |
| InChI | InChI=1S/C19H19FN4O2/c1-11-22-17(13-4-5-26-10-13)8-18(23-11)21-9-14-6-12-2-3-15(20)7-16(12)24-19(14)25/h2-3,6-8,13H,4-5,9-10H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | OSWGEUQOGXCZPB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |