C13H19N7O — CID 126426383
2-methyl-6-[(3R)-oxolan-3-yl]-N-[3-(2H-tetrazol-5-yl)propyl]pyrimidin-4-amine (PubChem CID 126426383) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-methyl-6-[(3R)-oxolan-3-yl]-N-[3-(2H-tetrazol-5-yl)propyl]pyrimidin-4-amine.
| Compound Name | 2-methyl-6-[(3R)-oxolan-3-yl]-N-[3-(2H-tetrazol-5-yl)propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 126426383 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-methyl-6-[(3R)-oxolan-3-yl]-N-[3-(2H-tetrazol-5-yl)propyl]pyrimidin-4-amine |
| SMILES | Cc1nc(NCCCc2nn[nH]n2)cc([C@H]2CCOC2)n1 |
| InChI | InChI=1S/C13H19N7O/c1-9-15-11(10-4-6-21-8-10)7-13(16-9)14-5-2-3-12-17-19-20-18-12/h7,10H,2-6,8H2,1H3,(H,14,15,16)(H,17,18,19,20)/t10-/m0/s1 |
| InChIKey | SYGYEIYQNWEWAQ-JTQLQIEISA-N |
| XLogP | 0.85 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|