C11H17N7 — CID 50962885
2-methyl-6-propan-2-yl-N-[2-(2H-tetrazol-5-yl)ethyl]pyrimidin-4-amine (PubChem CID 50962885) has the molecular formula C11H17N7 and a molecular weight of 247.31 g/mol. Its IUPAC name is 2-methyl-6-propan-2-yl-N-[2-(2H-tetrazol-5-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-methyl-6-propan-2-yl-N-[2-(2H-tetrazol-5-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 50962885 |
| Molecular Formula | C11H17N7 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2-methyl-6-propan-2-yl-N-[2-(2H-tetrazol-5-yl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1nc(NCCc2nn[nH]n2)cc(C(C)C)n1 |
| InChI | InChI=1S/C11H17N7/c1-7(2)9-6-11(14-8(3)13-9)12-5-4-10-15-17-18-16-10/h6-7H,4-5H2,1-3H3,(H,12,13,14)(H,15,16,17,18) |
| InChIKey | DJNPSKBKGRLXCA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |