C17H21N5O2 — CID 95827217
3-[2-methyl-6-(1-pyrazin-2-ylpiperidin-4-yl)pyrimidin-4-yl]propanoic acid (PubChem CID 95827217) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 3-[2-methyl-6-(1-pyrazin-2-ylpiperidin-4-yl)pyrimidin-4-yl]propanoic acid.
| Compound Name | 3-[2-methyl-6-(1-pyrazin-2-ylpiperidin-4-yl)pyrimidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 95827217 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 3-[2-methyl-6-(1-pyrazin-2-ylpiperidin-4-yl)pyrimidin-4-yl]propanoic acid |
| SMILES | Cc1nc(CCC(=O)O)cc(C2CCN(c3cnccn3)CC2)n1 |
| InChI | InChI=1S/C17H21N5O2/c1-12-20-14(2-3-17(23)24)10-15(21-12)13-4-8-22(9-5-13)16-11-18-6-7-19-16/h6-7,10-11,13H,2-5,8-9H2,1H3,(H,23,24) |
| InChIKey | JNCLZJKOOJDAPF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |