C18H26N4O2 — CID 95827585
1-[(2S)-2-[4-(5-methyl-2-pyridinyl)piperidine-1-carbonyl]piperazin-1-yl]ethanone (PubChem CID 95827585) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[(2S)-2-[4-(5-methyl-2-pyridinyl)piperidine-1-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-[4-(5-methyl-2-pyridinyl)piperidine-1-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 95827585 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-[(2S)-2-[4-(5-methyl-2-pyridinyl)piperidine-1-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCNC[C@H]1C(=O)N1CCC(c2ccc(C)cn2)CC1 |
| InChI | InChI=1S/C18H26N4O2/c1-13-3-4-16(20-11-13)15-5-8-21(9-6-15)18(24)17-12-19-7-10-22(17)14(2)23/h3-4,11,15,17,19H,5-10,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | RPAWCGDTBBNEPT-KRWDZBQOSA-N |
| XLogP | 0.92 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |