About [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone
[(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone (PubChem CID 95829883) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone.
Molecular Properties
| Compound Name | [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone |
| PubChem CID | 95829883 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone |
| SMILES | Cc1cc(C)nc([C@@H]2CCN(C(=O)C3CCOCC3)C2)n1 |
| InChI | InChI=1S/C16H23N3O2/c1-11-9-12(2)18-15(17-11)14-3-6-19(10-14)16(20)13-4-7-21-8-5-13/h9,13-14H,3-8,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | GACWQRHSDAAAQY-CQSZACIVSA-N |
| XLogP | 1.84 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone?
The IUPAC name of [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone (CID 95829883) is [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone.
What is the SMILES notation for [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone?
The canonical SMILES for [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone is Cc1cc(C)nc([C@@H]2CCN(C(=O)C3CCOCC3)C2)n1.
What is the InChIKey of [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone?
The InChIKey is GACWQRHSDAAAQY-CQSZACIVSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-11-9-12(2)18-15(17-11)14-3-6-19(10-14)16(20)13-4-7-21-8-5-13/h9,13-14H,3-8,10H2,1-2H3/t14-/m1/s1.
What are the key properties of [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone?
[(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone has a molecular weight of 289.38 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]-(oxan-4-yl)methanone is sourced from PubChem (CID 95829883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).