C23H22N6O — CID 95830959
4-[4-[(2R)-4-(quinolin-8-ylmethyl)morpholin-2-yl]pyrimidin-5-yl]pyridin-2-amine (PubChem CID 95830959) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[4-[(2R)-4-(quinolin-8-ylmethyl)morpholin-2-yl]pyrimidin-5-yl]pyridin-2-amine.
| Compound Name | 4-[4-[(2R)-4-(quinolin-8-ylmethyl)morpholin-2-yl]pyrimidin-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 95830959 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-[4-[(2R)-4-(quinolin-8-ylmethyl)morpholin-2-yl]pyrimidin-5-yl]pyridin-2-amine |
| SMILES | Nc1cc(-c2cncnc2[C@H]2CN(Cc3cccc4cccnc34)CCO2)ccn1 |
| InChI | InChI=1S/C23H22N6O/c24-21-11-17(6-8-26-21)19-12-25-15-28-23(19)20-14-29(9-10-30-20)13-18-4-1-3-16-5-2-7-27-22(16)18/h1-8,11-12,15,20H,9-10,13-14H2,(H2,24,26)/t20-/m1/s1 |
| InChIKey | HFROSCCUIGFOBY-HXUWFJFHSA-N |
| XLogP | 3.24 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |