C23H20N6O2 — CID 95830957
[(2R)-2-[5-(2-amino-4-pyridinyl)pyrimidin-4-yl]morpholin-4-yl]-quinolin-5-ylmethanone (PubChem CID 95830957) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is [(2R)-2-[5-(2-amino-4-pyridinyl)pyrimidin-4-yl]morpholin-4-yl]-quinolin-5-ylmethanone.
| Compound Name | [(2R)-2-[5-(2-amino-4-pyridinyl)pyrimidin-4-yl]morpholin-4-yl]-quinolin-5-ylmethanone |
|---|---|
| PubChem CID | 95830957 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [(2R)-2-[5-(2-amino-4-pyridinyl)pyrimidin-4-yl]morpholin-4-yl]-quinolin-5-ylmethanone |
| SMILES | Nc1cc(-c2cncnc2[C@H]2CN(C(=O)c3cccc4ncccc34)CCO2)ccn1 |
| InChI | InChI=1S/C23H20N6O2/c24-21-11-15(6-8-27-21)18-12-25-14-28-22(18)20-13-29(9-10-31-20)23(30)17-3-1-5-19-16(17)4-2-7-26-19/h1-8,11-12,14,20H,9-10,13H2,(H2,24,27)/t20-/m1/s1 |
| InChIKey | HDDFVHCYTFEYET-HXUWFJFHSA-N |
| XLogP | 2.88 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |