C15H17N5O2 — CID 95835385
2-hydroxy-1-[(2R)-2-[6-(pyrazin-2-ylamino)-2-pyridinyl]pyrrolidin-1-yl]ethanone (PubChem CID 95835385) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-hydroxy-1-[(2R)-2-[6-(pyrazin-2-ylamino)-2-pyridinyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-hydroxy-1-[(2R)-2-[6-(pyrazin-2-ylamino)-2-pyridinyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95835385 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-hydroxy-1-[(2R)-2-[6-(pyrazin-2-ylamino)-2-pyridinyl]pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CO)N1CCC[C@@H]1c1cccc(Nc2cnccn2)n1 |
| InChI | InChI=1S/C15H17N5O2/c21-10-15(22)20-8-2-4-12(20)11-3-1-5-13(18-11)19-14-9-16-6-7-17-14/h1,3,5-7,9,12,21H,2,4,8,10H2,(H,17,18,19)/t12-/m1/s1 |
| InChIKey | SMCJUSPTDSAVLJ-GFCCVEGCSA-N |
| XLogP | 1.27 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |