C23H26N6O — CID 95838014
4-phenyl-1-[(2S)-2-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]butan-1-one (PubChem CID 95838014) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-phenyl-1-[(2S)-2-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]butan-1-one.
| Compound Name | 4-phenyl-1-[(2S)-2-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 95838014 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 4-phenyl-1-[(2S)-2-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]butan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1CCCC[C@H]1c1ccnc(Nc2cnccn2)n1 |
| InChI | InChI=1S/C23H26N6O/c30-22(11-6-9-18-7-2-1-3-8-18)29-16-5-4-10-20(29)19-12-13-26-23(27-19)28-21-17-24-14-15-25-21/h1-3,7-8,12-15,17,20H,4-6,9-11,16H2,(H,25,26,27,28)/t20-/m0/s1 |
| InChIKey | HMDGHJHCYLJAAH-FQEVSTJZSA-N |
| XLogP | 4.09 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |