C19H20N6O — CID 95837810
4-[[(2S)-2-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]methyl]phenol (PubChem CID 95837810) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-[[(2S)-2-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]methyl]phenol.
| Compound Name | 4-[[(2S)-2-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 95837810 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4-[[(2S)-2-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]methyl]phenol |
| SMILES | Oc1ccc(CN2CCC[C@H]2c2ccnc(Nc3cnccn3)n2)cc1 |
| InChI | InChI=1S/C19H20N6O/c26-15-5-3-14(4-6-15)13-25-11-1-2-17(25)16-7-8-22-19(23-16)24-18-12-20-9-10-21-18/h3-10,12,17,26H,1-2,11,13H2,(H,21,22,23,24)/t17-/m0/s1 |
| InChIKey | DMWLZFGOBCPFMI-KRWDZBQOSA-N |
| XLogP | 3.05 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |