C17H16N2O2 — CID 958381
(Z)-2-cyano-3-(2-propan-2-yloxynaphthalen-1-yl)prop-2-enamide (PubChem CID 958381) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-propan-2-yloxynaphthalen-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-propan-2-yloxynaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 958381 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (Z)-2-cyano-3-(2-propan-2-yloxynaphthalen-1-yl)prop-2-enamide |
| SMILES | CC(C)Oc1ccc2ccccc2c1/C=C(/C#N)C(N)=O |
| InChI | InChI=1S/C17H16N2O2/c1-11(2)21-16-8-7-12-5-3-4-6-14(12)15(16)9-13(10-18)17(19)20/h3-9,11H,1-2H3,(H2,19,20)/b13-9- |
| InChIKey | WYALCMHGBSVNSY-LCYFTJDESA-N |
| XLogP | 3.02 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|