C22H16ClNO4 — CID 22687042
3-[2-[2-(2-chlorophenoxy)ethoxy]naphthalen-1-yl]-2-cyanoprop-2-enoic acid (PubChem CID 22687042) has the molecular formula C22H16ClNO4 and a molecular weight of 393.83 g/mol. Its IUPAC name is 3-[2-[2-(2-chlorophenoxy)ethoxy]naphthalen-1-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | 3-[2-[2-(2-chlorophenoxy)ethoxy]naphthalen-1-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 22687042 |
| Molecular Formula | C22H16ClNO4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 3-[2-[2-(2-chlorophenoxy)ethoxy]naphthalen-1-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#CC(=Cc1c(OCCOc2ccccc2Cl)ccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C22H16ClNO4/c23-19-7-3-4-8-21(19)28-12-11-27-20-10-9-15-5-1-2-6-17(15)18(20)13-16(14-24)22(25)26/h1-10,13H,11-12H2,(H,25,26) |
| InChIKey | DSPCFJRDZYSUKV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|